C35H48N2O6S — CID 129027501
butyl 4-[2-bicyclo[2.2.1]hept-5-enylmethyl-[2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]amino]-2-butoxybenzoate (PubChem CID 129027501) has the molecular formula C35H48N2O6S and a molecular weight of 624.84 g/mol. Its IUPAC name is butyl 4-[2-bicyclo[2.2.1]hept-5-enylmethyl-[2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]amino]-2-butoxybenzoate.
| Compound Name | butyl 4-[2-bicyclo[2.2.1]hept-5-enylmethyl-[2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]amino]-2-butoxybenzoate |
|---|---|
| PubChem CID | 129027501 |
| Molecular Formula | C35H48N2O6S |
| Molecular Weight | 624.84 g/mol |
| Exact Mass | 624.32 |
| IUPAC Name | butyl 4-[2-bicyclo[2.2.1]hept-5-enylmethyl-[2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]amino]-2-butoxybenzoate |
| SMILES | CCCCOC(=O)c1ccc(N(CC2CC3C=CC2C3)C(=O)CN(C)S(=O)(=O)c2c(C)cc(C)cc2C)cc1OCCCC |
| InChI | InChI=1S/C35H48N2O6S/c1-7-9-15-42-32-21-30(13-14-31(32)35(39)43-16-10-8-2)37(22-29-20-27-11-12-28(29)19-27)33(38)23-36(6)44(40,41)34-25(4)17-24(3)18-26(34)5/h11-14,17-18,21,27-29H,7-10,15-16,19-20,22-23H2,1-6H3 |
| InChIKey | FURBJUMUQGOLAV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.84 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|