C36H25F6N2O6S- — CID 126744074
1,2,3,4,5-pentafluoro-6-[[2-[N-[(4-fluorophenyl)methyl]-3-phenylmethoxy-4-phenylmethoxycarbonylanilino]-2-oxoethyl]-sulfinatoamino]benzene (PubChem CID 126744074) has the molecular formula C36H25F6N2O6S- and a molecular weight of 727.66 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[[2-[N-[(4-fluorophenyl)methyl]-3-phenylmethoxy-4-phenylmethoxycarbonylanilino]-2-oxoethyl]-sulfinatoamino]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[[2-[N-[(4-fluorophenyl)methyl]-3-phenylmethoxy-4-phenylmethoxycarbonylanilino]-2-oxoethyl]-sulfinatoamino]benzene |
|---|---|
| PubChem CID | 126744074 |
| Molecular Formula | C36H25F6N2O6S- |
| Molecular Weight | 727.66 g/mol |
| Exact Mass | 727.13 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[[2-[N-[(4-fluorophenyl)methyl]-3-phenylmethoxy-4-phenylmethoxycarbonylanilino]-2-oxoethyl]-sulfinatoamino]benzene |
| SMILES | O=C(OCc1ccccc1)c1ccc(N(Cc2ccc(F)cc2)C(=O)CN(c2c(F)c(F)c(F)c(F)c2F)S(=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C36H26F6N2O6S/c37-25-13-11-22(12-14-25)18-43(29(45)19-44(51(47)48)35-33(41)31(39)30(38)32(40)34(35)42)26-15-16-27(36(46)50-21-24-9-5-2-6-10-24)28(17-26)49-20-23-7-3-1-4-8-23/h1-17H,18-21H2,(H,47,48)/p-1 |
| InChIKey | DFSBQDCDLGWMNL-UHFFFAOYSA-M |
| XLogP | 7.29 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.66 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|