C43H47F5N2O4S — CID 142404569
benzyl 4-[[2-(ethylamino)acetyl]-[(2E,4E)-2,5,6-trimethylnona-2,4-dienyl]amino]-2-phenylmethoxybenzoate;2,3,4,5,6-pentafluorobenzenethiol (PubChem CID 142404569) has the molecular formula C43H47F5N2O4S and a molecular weight of 782.92 g/mol. Its IUPAC name is benzyl 4-[[2-(ethylamino)acetyl]-[(2E,4E)-2,5,6-trimethylnona-2,4-dienyl]amino]-2-phenylmethoxybenzoate;2,3,4,5,6-pentafluorobenzenethiol.
| Compound Name | benzyl 4-[[2-(ethylamino)acetyl]-[(2E,4E)-2,5,6-trimethylnona-2,4-dienyl]amino]-2-phenylmethoxybenzoate;2,3,4,5,6-pentafluorobenzenethiol |
|---|---|
| PubChem CID | 142404569 |
| Molecular Formula | C43H47F5N2O4S |
| Molecular Weight | 782.92 g/mol |
| Exact Mass | 782.32 |
| IUPAC Name | benzyl 4-[[2-(ethylamino)acetyl]-[(2E,4E)-2,5,6-trimethylnona-2,4-dienyl]amino]-2-phenylmethoxybenzoate;2,3,4,5,6-pentafluorobenzenethiol |
| SMILES | CCCC(C)/C(C)=C/C=C(\C)CN(C(=O)CNCC)c1ccc(C(=O)OCc2ccccc2)c(OCc2ccccc2)c1.Fc1c(F)c(F)c(S)c(F)c1F |
| InChI | InChI=1S/C37H46N2O4.C6HF5S/c1-6-14-29(4)30(5)20-19-28(3)25-39(36(40)24-38-7-2)33-21-22-34(37(41)43-27-32-17-12-9-13-18-32)35(23-33)42-26-31-15-10-8-11-16-31;7-1-2(8)4(10)6(12)5(11)3(1)9/h8-13,15-23,29,38H,6-7,14,24-27H2,1-5H3;12H/b28-19+,30-20+; |
| InChIKey | UFQYMMRUJFLNLM-WXDSLRBFSA-N |
| XLogP | 10.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.92 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|