C37H28F6N2O4S — CID 139539445
benzyl 4-[(4-fluorophenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]-2-phenylmethoxybenzoate (PubChem CID 139539445) has the molecular formula C37H28F6N2O4S and a molecular weight of 710.70 g/mol. Its IUPAC name is benzyl 4-[(4-fluorophenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]-2-phenylmethoxybenzoate.
| Compound Name | benzyl 4-[(4-fluorophenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]-2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 139539445 |
| Molecular Formula | C37H28F6N2O4S |
| Molecular Weight | 710.70 g/mol |
| Exact Mass | 710.17 |
| IUPAC Name | benzyl 4-[(4-fluorophenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]-2-phenylmethoxybenzoate |
| SMILES | CN(CC(=O)N(Cc1ccc(F)cc1)c1ccc(C(=O)OCc2ccccc2)c(OCc2ccccc2)c1)Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C37H28F6N2O4S/c1-44(50-36-34(42)32(40)31(39)33(41)35(36)43)20-30(46)45(19-23-12-14-26(38)15-13-23)27-16-17-28(37(47)49-22-25-10-6-3-7-11-25)29(18-27)48-21-24-8-4-2-5-9-24/h2-18H,19-22H2,1H3 |
| InChIKey | OJDPOFBMSXXBIW-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.70 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|