C26H27FN2O3S — CID 139539507
4-[(4-fluorophenyl)methyl-[2-[methyl-(2,4,6-trimethylphenyl)sulfanylamino]acetyl]amino]benzoic acid (PubChem CID 139539507) has the molecular formula C26H27FN2O3S and a molecular weight of 466.58 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl-[2-[methyl-(2,4,6-trimethylphenyl)sulfanylamino]acetyl]amino]benzoic acid.
| Compound Name | 4-[(4-fluorophenyl)methyl-[2-[methyl-(2,4,6-trimethylphenyl)sulfanylamino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 139539507 |
| Molecular Formula | C26H27FN2O3S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl-[2-[methyl-(2,4,6-trimethylphenyl)sulfanylamino]acetyl]amino]benzoic acid |
| SMILES | Cc1cc(C)c(SN(C)CC(=O)N(Cc2ccc(F)cc2)c2ccc(C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C26H27FN2O3S/c1-17-13-18(2)25(19(3)14-17)33-28(4)16-24(30)29(15-20-5-9-22(27)10-6-20)23-11-7-21(8-12-23)26(31)32/h5-14H,15-16H2,1-4H3,(H,31,32) |
| InChIKey | ZHBDVLZVSQLBJY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|