C26H32N2O5 — CID 142214563
4-[(3,4-dimethylphenyl)methyl-[4-[methyl(2-methylbutan-2-yl)amino]-3,4-dioxobutanoyl]amino]benzoic acid (PubChem CID 142214563) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)methyl-[4-[methyl(2-methylbutan-2-yl)amino]-3,4-dioxobutanoyl]amino]benzoic acid.
| Compound Name | 4-[(3,4-dimethylphenyl)methyl-[4-[methyl(2-methylbutan-2-yl)amino]-3,4-dioxobutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 142214563 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)methyl-[4-[methyl(2-methylbutan-2-yl)amino]-3,4-dioxobutanoyl]amino]benzoic acid |
| SMILES | CCC(C)(C)N(C)C(=O)C(=O)CC(=O)N(Cc1ccc(C)c(C)c1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H32N2O5/c1-7-26(4,5)27(6)24(31)22(29)15-23(30)28(16-19-9-8-17(2)18(3)14-19)21-12-10-20(11-13-21)25(32)33/h8-14H,7,15-16H2,1-6H3,(H,32,33) |
| InChIKey | IESGSRYBIFRFOH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|