C17H15ClF5NO2S — CID 142404731
methoxymethylbenzene;2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl chloride (PubChem CID 142404731) has the molecular formula C17H15ClF5NO2S and a molecular weight of 427.82 g/mol. Its IUPAC name is methoxymethylbenzene;2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl chloride.
| Compound Name | methoxymethylbenzene;2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl chloride |
|---|---|
| PubChem CID | 142404731 |
| Molecular Formula | C17H15ClF5NO2S |
| Molecular Weight | 427.82 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | methoxymethylbenzene;2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl chloride |
| SMILES | CN(CC(=O)Cl)Sc1c(F)c(F)c(F)c(F)c1F.COCc1ccccc1 |
| InChI | InChI=1S/C9H5ClF5NOS.C8H10O/c1-16(2-3(10)17)18-9-7(14)5(12)4(11)6(13)8(9)15;1-9-7-8-5-3-2-4-6-8/h2H2,1H3;2-6H,7H2,1H3 |
| InChIKey | IFPAFJMKBQTUGE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.82 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|