C27H24F5N3O4S — CID 135257868
2-[(4-cyclohexylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-2-carbonyl]amino]-1,3-oxazole-4-carboxylic acid (PubChem CID 135257868) has the molecular formula C27H24F5N3O4S and a molecular weight of 581.56 g/mol. Its IUPAC name is 2-[(4-cyclohexylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-2-carbonyl]amino]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[(4-cyclohexylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-2-carbonyl]amino]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 135257868 |
| Molecular Formula | C27H24F5N3O4S |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | 2-[(4-cyclohexylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-2-carbonyl]amino]-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(N(Cc2ccc(C3CCCCC3)cc2)C(=O)[C@H]2CCN2Sc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C27H24F5N3O4S/c28-19-20(29)22(31)24(23(32)21(19)30)40-35-11-10-18(35)25(36)34(27-33-17(13-39-27)26(37)38)12-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h6-9,13,15,18H,1-5,10-12H2,(H,37,38)/t18-/m1/s1 |
| InChIKey | ZARHMSGABUUOPI-GOSISDBHSA-N |
| XLogP | 6.43 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|