C30H29F5N6O2S — CID 135257759
(2R)-N-[(4-cyclohexylphenyl)methyl]-N-[4-(N-hydrazinylidenecarbamimidoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfinylazetidine-2-carboxamide (PubChem CID 135257759) has the molecular formula C30H29F5N6O2S and a molecular weight of 632.66 g/mol. Its IUPAC name is (2R)-N-[(4-cyclohexylphenyl)methyl]-N-[4-(N-hydrazinylidenecarbamimidoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfinylazetidine-2-carboxamide.
| Compound Name | (2R)-N-[(4-cyclohexylphenyl)methyl]-N-[4-(N-hydrazinylidenecarbamimidoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfinylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 135257759 |
| Molecular Formula | C30H29F5N6O2S |
| Molecular Weight | 632.66 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | (2R)-N-[(4-cyclohexylphenyl)methyl]-N-[4-(N-hydrazinylidenecarbamimidoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfinylazetidine-2-carboxamide |
| SMILES | [H]/N=C(\N=N\N)c1ccc(N(Cc2ccc(C3CCCCC3)cc2)C(=O)[C@H]2CCN2S(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C30H29F5N6O2S/c31-23-24(32)26(34)28(27(35)25(23)33)44(43)41-15-14-22(41)30(42)40(21-12-10-20(11-13-21)29(36)38-39-37)16-17-6-8-19(9-7-17)18-4-2-1-3-5-18/h6-13,18,22H,1-5,14-16H2,(H3,36,37,38)/t22-,44?/m1/s1 |
| InChIKey | DEIHAJYLTLBLGJ-BOAYRYIOSA-N |
| XLogP | 6.41 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|