C38H28F10N2O5S — CID 168753099
3-cyclopropyl-4-[(3,5-dicyclopropylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid (PubChem CID 168753099) has the molecular formula C38H28F10N2O5S and a molecular weight of 814.70 g/mol. Its IUPAC name is 3-cyclopropyl-4-[(3,5-dicyclopropylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid.
| Compound Name | 3-cyclopropyl-4-[(3,5-dicyclopropylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 168753099 |
| Molecular Formula | C38H28F10N2O5S |
| Molecular Weight | 814.70 g/mol |
| Exact Mass | 814.16 |
| IUPAC Name | 3-cyclopropyl-4-[(3,5-dicyclopropylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2cc(C3CC3)cc(C3CC3)c2)C(=O)CN(Cc2c(F)c(F)c(F)c(F)c2F)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c(C2CC2)c1 |
| InChI | InChI=1S/C38H28F10N2O5S/c39-27-24(28(40)30(42)31(43)29(27)41)14-49(56(54,55)37-35(47)33(45)32(44)34(46)36(37)48)15-26(51)50(25-8-7-20(38(52)53)12-23(25)19-5-6-19)13-16-9-21(17-1-2-17)11-22(10-16)18-3-4-18/h7-12,17-19H,1-6,13-15H2,(H,52,53) |
| InChIKey | YEFTVOMBCVLVEM-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.70 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|