C37H33ClF6N2O5S — CID 156851831
4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-methylbenzoic acid (PubChem CID 156851831) has the molecular formula C37H33ClF6N2O5S and a molecular weight of 767.19 g/mol. Its IUPAC name is 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-methylbenzoic acid.
| Compound Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 156851831 |
| Molecular Formula | C37H33ClF6N2O5S |
| Molecular Weight | 767.19 g/mol |
| Exact Mass | 766.17 |
| IUPAC Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1N(Cc1cc(C2CC2)cc(C(C)(C)C)c1)C(=O)CN(Cc1ccc(F)cc1Cl)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C37H33ClF6N2O5S/c1-19-11-22(36(48)49)8-10-28(19)46(16-20-12-24(21-5-6-21)14-25(13-20)37(2,3)4)29(47)18-45(17-23-7-9-26(39)15-27(23)38)52(50,51)35-33(43)31(41)30(40)32(42)34(35)44/h7-15,21H,5-6,16-18H2,1-4H3,(H,48,49) |
| InChIKey | SRFCIQYKNYEZEQ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.19 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|