C39H35F4N3O6S — CID 162751710
4-[[2-[(2-cyanophenyl)methyl-(2,3,4,5-tetrafluoro-6-methylphenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid (PubChem CID 162751710) has the molecular formula C39H35F4N3O6S and a molecular weight of 749.78 g/mol. Its IUPAC name is 4-[[2-[(2-cyanophenyl)methyl-(2,3,4,5-tetrafluoro-6-methylphenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid.
| Compound Name | 4-[[2-[(2-cyanophenyl)methyl-(2,3,4,5-tetrafluoro-6-methylphenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid |
|---|---|
| PubChem CID | 162751710 |
| Molecular Formula | C39H35F4N3O6S |
| Molecular Weight | 749.78 g/mol |
| Exact Mass | 749.22 |
| IUPAC Name | 4-[[2-[(2-cyanophenyl)methyl-(2,3,4,5-tetrafluoro-6-methylphenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)ccc1N(Cc1cc(C2CC2)cc(C2CC2)c1)C(=O)CN(Cc1ccccc1C#N)S(=O)(=O)c1c(C)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C39H35F4N3O6S/c1-3-52-32-17-26(39(48)49)12-13-31(32)46(19-23-14-29(24-8-9-24)16-30(15-23)25-10-11-25)33(47)21-45(20-28-7-5-4-6-27(28)18-44)53(50,51)38-22(2)34(40)35(41)36(42)37(38)43/h4-7,12-17,24-25H,3,8-11,19-21H2,1-2H3,(H,48,49) |
| InChIKey | VPLBSZIQYGJWTE-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.78 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|