C33H33F5N2O6S — CID 156851937
4-[[2-[[(2R)-2-bicyclo[3.1.1]heptanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3-tert-butylphenyl)methyl]amino]-2-hydroxybenzoic acid (PubChem CID 156851937) has the molecular formula C33H33F5N2O6S and a molecular weight of 680.69 g/mol. Its IUPAC name is 4-[[2-[[(2R)-2-bicyclo[3.1.1]heptanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3-tert-butylphenyl)methyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[2-[[(2R)-2-bicyclo[3.1.1]heptanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3-tert-butylphenyl)methyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 156851937 |
| Molecular Formula | C33H33F5N2O6S |
| Molecular Weight | 680.69 g/mol |
| Exact Mass | 680.20 |
| IUPAC Name | 4-[[2-[[(2R)-2-bicyclo[3.1.1]heptanyl]-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3-tert-butylphenyl)methyl]amino]-2-hydroxybenzoic acid |
| SMILES | CC(C)(C)c1cccc(CN(C(=O)CN([C@@H]2CCC3CC2C3)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c2ccc(C(=O)O)c(O)c2)c1 |
| InChI | InChI=1S/C33H33F5N2O6S/c1-33(2,3)20-6-4-5-18(13-20)15-39(21-8-9-22(32(43)44)24(41)14-21)25(42)16-40(23-10-7-17-11-19(23)12-17)47(45,46)31-29(37)27(35)26(34)28(36)30(31)38/h4-6,8-9,13-14,17,19,23,41H,7,10-12,15-16H2,1-3H3,(H,43,44)/t17?,19?,23-/m1/s1 |
| InChIKey | KUTBLKJGUKNTNC-MCSCQSGASA-N |
| XLogP | 6.50 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.69 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|