C39H38F6N2O6S — CID 156851773
4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[(3R)-3-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]butanoyl]amino]-3-methoxybenzoic acid (PubChem CID 156851773) has the molecular formula C39H38F6N2O6S and a molecular weight of 776.80 g/mol. Its IUPAC name is 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[(3R)-3-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]butanoyl]amino]-3-methoxybenzoic acid.
| Compound Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[(3R)-3-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]butanoyl]amino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 156851773 |
| Molecular Formula | C39H38F6N2O6S |
| Molecular Weight | 776.80 g/mol |
| Exact Mass | 776.24 |
| IUPAC Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[(3R)-3-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]butanoyl]amino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1N(Cc1cc(C2CC2)cc(C(C)(C)C)c1)C(=O)C[C@@H](C)N(Cc1ccccc1F)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C39H38F6N2O6S/c1-21(47(20-25-8-6-7-9-28(25)40)54(51,52)37-35(44)33(42)32(41)34(43)36(37)45)14-31(48)46(29-13-12-24(38(49)50)18-30(29)53-5)19-22-15-26(23-10-11-23)17-27(16-22)39(2,3)4/h6-9,12-13,15-18,21,23H,10-11,14,19-20H2,1-5H3,(H,49,50)/t21-/m1/s1 |
| InChIKey | ZGOGKQBIYGXJHW-OAQYLSRUSA-N |
| XLogP | 8.61 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.80 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|