C19H16ClF6NO4S — CID 156851734
tert-butyl 2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetate (PubChem CID 156851734) has the molecular formula C19H16ClF6NO4S and a molecular weight of 503.85 g/mol. Its IUPAC name is tert-butyl 2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetate.
| Compound Name | tert-butyl 2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 156851734 |
| Molecular Formula | C19H16ClF6NO4S |
| Molecular Weight | 503.85 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | tert-butyl 2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(Cc1ccc(F)cc1Cl)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H16ClF6NO4S/c1-19(2,3)31-12(28)8-27(7-9-4-5-10(21)6-11(9)20)32(29,30)18-16(25)14(23)13(22)15(24)17(18)26/h4-6H,7-8H2,1-3H3 |
| InChIKey | FCDMHMUDFSBZGF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.85 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|