C16H9ClF5NO6S — CID 167858709
2-[(7-chloro-1,3-benzodioxol-5-yl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetic acid (PubChem CID 167858709) has the molecular formula C16H9ClF5NO6S and a molecular weight of 473.76 g/mol. Its IUPAC name is 2-[(7-chloro-1,3-benzodioxol-5-yl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[(7-chloro-1,3-benzodioxol-5-yl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 167858709 |
| Molecular Formula | C16H9ClF5NO6S |
| Molecular Weight | 473.76 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | 2-[(7-chloro-1,3-benzodioxol-5-yl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetic acid |
| SMILES | O=C(O)CN(Cc1cc(Cl)c2c(c1)OCO2)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H9ClF5NO6S/c17-7-1-6(2-8-15(7)29-5-28-8)3-23(4-9(24)25)30(26,27)16-13(21)11(19)10(18)12(20)14(16)22/h1-2H,3-5H2,(H,24,25) |
| InChIKey | SMCMZPNJRDCUPG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.76 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|