C20H19ClN2O2S — CID 121084535
3-chloro-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide (PubChem CID 121084535) has the molecular formula C20H19ClN2O2S and a molecular weight of 386.90 g/mol. Its IUPAC name is 3-chloro-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-chloro-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 121084535 |
| Molecular Formula | C20H19ClN2O2S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 3-chloro-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N(CCc1ccccc1)Cc1ccccn1 |
| InChI | InChI=1S/C20H19ClN2O2S/c21-18-9-6-11-20(15-18)26(24,25)23(16-19-10-4-5-13-22-19)14-12-17-7-2-1-3-8-17/h1-11,13,15H,12,14,16H2 |
| InChIKey | VUMAMCKYBNSELP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |