C27H27N3O2S — CID 59826052
N,N-dibenzyl-3-[(pyridin-2-ylmethylamino)methyl]benzenesulfonamide (PubChem CID 59826052) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is N,N-dibenzyl-3-[(pyridin-2-ylmethylamino)methyl]benzenesulfonamide.
| Compound Name | N,N-dibenzyl-3-[(pyridin-2-ylmethylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59826052 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N,N-dibenzyl-3-[(pyridin-2-ylmethylamino)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1cccc(CNCc2ccccn2)c1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H27N3O2S/c31-33(32,27-16-9-14-25(18-27)19-28-20-26-15-7-8-17-29-26)30(21-23-10-3-1-4-11-23)22-24-12-5-2-6-13-24/h1-18,28H,19-22H2 |
| InChIKey | ANDDKGNFNAAXKR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |