C14H13ClN2O4S — CID 146128222
2-[(3-chlorophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]acetic acid (PubChem CID 146128222) has the molecular formula C14H13ClN2O4S and a molecular weight of 340.79 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]acetic acid.
| Compound Name | 2-[(3-chlorophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 146128222 |
| Molecular Formula | C14H13ClN2O4S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-[(3-chlorophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccccn1)S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H13ClN2O4S/c15-11-4-3-6-13(8-11)22(20,21)17(10-14(18)19)9-12-5-1-2-7-16-12/h1-8H,9-10H2,(H,18,19) |
| InChIKey | ZZWNKELHVGAKRF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |