C19H23ClN2O3S — CID 7917886
2-[benzyl-(3-chlorophenyl)sulfonylamino]-N,N-diethylacetamide (PubChem CID 7917886) has the molecular formula C19H23ClN2O3S and a molecular weight of 394.92 g/mol. Its IUPAC name is 2-[benzyl-(3-chlorophenyl)sulfonylamino]-N,N-diethylacetamide.
| Compound Name | 2-[benzyl-(3-chlorophenyl)sulfonylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 7917886 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-[benzyl-(3-chlorophenyl)sulfonylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(Cc1ccccc1)S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H23ClN2O3S/c1-3-21(4-2)19(23)15-22(14-16-9-6-5-7-10-16)26(24,25)18-12-8-11-17(20)13-18/h5-13H,3-4,14-15H2,1-2H3 |
| InChIKey | UJUVISFBDPYFJT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |