C12H18ClNO4S — CID 54877176
4-(2-chloroethyl)-N,N-bis(2-hydroxyethyl)benzenesulfonamide (PubChem CID 54877176) has the molecular formula C12H18ClNO4S and a molecular weight of 307.80 g/mol. Its IUPAC name is 4-(2-chloroethyl)-N,N-bis(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-(2-chloroethyl)-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54877176 |
| Molecular Formula | C12H18ClNO4S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 4-(2-chloroethyl)-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(CCCl)cc1)N(CCO)CCO |
| InChI | InChI=1S/C12H18ClNO4S/c13-6-5-11-1-3-12(4-2-11)19(17,18)14(7-9-15)8-10-16/h1-4,15-16H,5-10H2 |
| InChIKey | SYBXHAFPFSGGED-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|