C12H20N2O3S — CID 61355533
N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)propane-2-sulfonamide (PubChem CID 61355533) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)propane-2-sulfonamide.
| Compound Name | N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 61355533 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)propane-2-sulfonamide |
| SMILES | COCCN(Cc1ccccn1)S(=O)(=O)C(C)C |
| InChI | InChI=1S/C12H20N2O3S/c1-11(2)18(15,16)14(8-9-17-3)10-12-6-4-5-7-13-12/h4-7,11H,8-10H2,1-3H3 |
| InChIKey | ATEITABAJJTRES-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |