C24H32N4O5S — CID 20861509
2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-[3-(N-methylanilino)propyl]acetamide (PubChem CID 20861509) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-[3-(N-methylanilino)propyl]acetamide.
| Compound Name | 2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-[3-(N-methylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 20861509 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-[3-(N-methylanilino)propyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)N(CC(=O)NCCCN(C)c1ccccc1)C(=O)CO2 |
| InChI | InChI=1S/C24H32N4O5S/c1-4-27(5-2)34(31,32)20-12-13-22-21(16-20)28(24(30)18-33-22)17-23(29)25-14-9-15-26(3)19-10-7-6-8-11-19/h6-8,10-13,16H,4-5,9,14-15,17-18H2,1-3H3,(H,25,29) |
| InChIKey | NWRRKBPWYQWKMY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|