C18H27N3O7S — CID 46255551
2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-(2,2-dimethoxyethyl)acetamide (PubChem CID 46255551) has the molecular formula C18H27N3O7S and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-(2,2-dimethoxyethyl)acetamide.
| Compound Name | 2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-(2,2-dimethoxyethyl)acetamide |
|---|---|
| PubChem CID | 46255551 |
| Molecular Formula | C18H27N3O7S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-(2,2-dimethoxyethyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)N(CC(=O)NCC(OC)OC)C(=O)CO2 |
| InChI | InChI=1S/C18H27N3O7S/c1-5-20(6-2)29(24,25)13-7-8-15-14(9-13)21(17(23)12-28-15)11-16(22)19-10-18(26-3)27-4/h7-9,18H,5-6,10-12H2,1-4H3,(H,19,22) |
| InChIKey | QSHRKMKEDIOWNR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|