C20H23N3O4S — CID 55533528
3-oxo-N-(2-phenyl-2-pyrrolidin-1-ylethyl)-4H-1,4-benzoxazine-6-sulfonamide (PubChem CID 55533528) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-oxo-N-(2-phenyl-2-pyrrolidin-1-ylethyl)-4H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | 3-oxo-N-(2-phenyl-2-pyrrolidin-1-ylethyl)-4H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 55533528 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-oxo-N-(2-phenyl-2-pyrrolidin-1-ylethyl)-4H-1,4-benzoxazine-6-sulfonamide |
| SMILES | O=C1COc2ccc(S(=O)(=O)NCC(c3ccccc3)N3CCCC3)cc2N1 |
| InChI | InChI=1S/C20H23N3O4S/c24-20-14-27-19-9-8-16(12-17(19)22-20)28(25,26)21-13-18(23-10-4-5-11-23)15-6-2-1-3-7-15/h1-3,6-9,12,18,21H,4-5,10-11,13-14H2,(H,22,24) |
| InChIKey | PXOQLUKFXOWMJW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |