C16H26N2O3S — CID 82098729
N-hexyl-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine-6-sulfonamide (PubChem CID 82098729) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-hexyl-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N-hexyl-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 82098729 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-hexyl-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine-6-sulfonamide |
| SMILES | CCCCCCNS(=O)(=O)c1ccc2c(c1)NCC(C)(C)O2 |
| InChI | InChI=1S/C16H26N2O3S/c1-4-5-6-7-10-18-22(19,20)13-8-9-15-14(11-13)17-12-16(2,3)21-15/h8-9,11,17-18H,4-7,10,12H2,1-3H3 |
| InChIKey | RUDMHVIKIIHHTQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|