C13H20N2O2S — CID 70981718
3,3-dimethyl-N-propyl-1,2-dihydroindole-6-sulfonamide (PubChem CID 70981718) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 3,3-dimethyl-N-propyl-1,2-dihydroindole-6-sulfonamide.
| Compound Name | 3,3-dimethyl-N-propyl-1,2-dihydroindole-6-sulfonamide |
|---|---|
| PubChem CID | 70981718 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3,3-dimethyl-N-propyl-1,2-dihydroindole-6-sulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccc2c(c1)NCC2(C)C |
| InChI | InChI=1S/C13H20N2O2S/c1-4-7-15-18(16,17)10-5-6-11-12(8-10)14-9-13(11,2)3/h5-6,8,14-15H,4,7,9H2,1-3H3 |
| InChIKey | RBWOBDVRSIEBGG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |