C14H22N2O2S — CID 107422191
N-hexyl-2,3-dihydro-1H-isoindole-5-sulfonamide (PubChem CID 107422191) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is N-hexyl-2,3-dihydro-1H-isoindole-5-sulfonamide.
| Compound Name | N-hexyl-2,3-dihydro-1H-isoindole-5-sulfonamide |
|---|---|
| PubChem CID | 107422191 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-hexyl-2,3-dihydro-1H-isoindole-5-sulfonamide |
| SMILES | CCCCCCNS(=O)(=O)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C14H22N2O2S/c1-2-3-4-5-8-16-19(17,18)14-7-6-12-10-15-11-13(12)9-14/h6-7,9,15-16H,2-5,8,10-11H2,1H3 |
| InChIKey | JXIWFOQTVHRXJP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|