C13H18N2O2S — CID 114264970
N-pent-4-enyl-2,3-dihydro-1H-isoindole-5-sulfonamide (PubChem CID 114264970) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is N-pent-4-enyl-2,3-dihydro-1H-isoindole-5-sulfonamide.
| Compound Name | N-pent-4-enyl-2,3-dihydro-1H-isoindole-5-sulfonamide |
|---|---|
| PubChem CID | 114264970 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-pent-4-enyl-2,3-dihydro-1H-isoindole-5-sulfonamide |
| SMILES | C=CCCCNS(=O)(=O)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C13H18N2O2S/c1-2-3-4-7-15-18(16,17)13-6-5-11-9-14-10-12(11)8-13/h2,5-6,8,14-15H,1,3-4,7,9-10H2 |
| InChIKey | FGCFIZRKIZPLAL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|