C12H15F3N2O3S — CID 107422169
N-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydro-1H-isoindole-5-sulfonamide (PubChem CID 107422169) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydro-1H-isoindole-5-sulfonamide.
| Compound Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydro-1H-isoindole-5-sulfonamide |
|---|---|
| PubChem CID | 107422169 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]-2,3-dihydro-1H-isoindole-5-sulfonamide |
| SMILES | O=S(=O)(NCCOCC(F)(F)F)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C12H15F3N2O3S/c13-12(14,15)8-20-4-3-17-21(18,19)11-2-1-9-6-16-7-10(9)5-11/h1-2,5,16-17H,3-4,6-8H2 |
| InChIKey | KYPLKKKQBWMGIM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|