C12H15Cl2N3O3S — CID 43256211
1-(2-amino-4,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 43256211) has the molecular formula C12H15Cl2N3O3S and a molecular weight of 352.24 g/mol. Its IUPAC name is 1-(2-amino-4,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-(2-amino-4,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 43256211 |
| Molecular Formula | C12H15Cl2N3O3S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 1-(2-amino-4,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(S(=O)(=O)c2c(N)cc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C12H15Cl2N3O3S/c13-8-5-9(14)11(10(15)6-8)21(19,20)17-3-1-7(2-4-17)12(16)18/h5-7H,1-4,15H2,(H2,16,18) |
| InChIKey | ZXURDGQFWCJRGE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|