C13H14ClF3N2O3S — CID 18170878
1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxamide (PubChem CID 18170878) has the molecular formula C13H14ClF3N2O3S and a molecular weight of 370.78 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxamide.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 18170878 |
| Molecular Formula | C13H14ClF3N2O3S |
| Molecular Weight | 370.78 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(S(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H14ClF3N2O3S/c14-11-4-3-9(6-10(11)13(15,16)17)23(21,22)19-5-1-2-8(7-19)12(18)20/h3-4,6,8H,1-2,5,7H2,(H2,18,20) |
| InChIKey | CNJRZCSBMASXLT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.78 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |