C11H17N3O4S — CID 54934456
ethyl 1-(1H-pyrazol-4-ylsulfonyl)piperidine-4-carboxylate (PubChem CID 54934456) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is ethyl 1-(1H-pyrazol-4-ylsulfonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(1H-pyrazol-4-ylsulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 54934456 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | ethyl 1-(1H-pyrazol-4-ylsulfonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cn[nH]c2)CC1 |
| InChI | InChI=1S/C11H17N3O4S/c1-2-18-11(15)9-3-5-14(6-4-9)19(16,17)10-7-12-13-8-10/h7-9H,2-6H2,1H3,(H,12,13) |
| InChIKey | CZFVFMVEZXXRJE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |