C21H30N2O5S — CID 4151785
ethyl 1-(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)piperidine-4-carboxylate (PubChem CID 4151785) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is ethyl 1-(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4151785 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | ethyl 1-(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2C)CC1 |
| InChI | InChI=1S/C21H30N2O5S/c1-3-28-21(25)17-9-13-22(14-10-17)20(24)19-15-18(8-7-16(19)2)29(26,27)23-11-5-4-6-12-23/h7-8,15,17H,3-6,9-14H2,1-2H3 |
| InChIKey | LMXNNYWKFASPGJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |