C19H26N2O7S — CID 43853493
ethyl 1-(2-hydroxy-5-morpholin-4-ylsulfonylbenzoyl)piperidine-3-carboxylate (PubChem CID 43853493) has the molecular formula C19H26N2O7S and a molecular weight of 426.49 g/mol. Its IUPAC name is ethyl 1-(2-hydroxy-5-morpholin-4-ylsulfonylbenzoyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(2-hydroxy-5-morpholin-4-ylsulfonylbenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 43853493 |
| Molecular Formula | C19H26N2O7S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | ethyl 1-(2-hydroxy-5-morpholin-4-ylsulfonylbenzoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2O)C1 |
| InChI | InChI=1S/C19H26N2O7S/c1-2-28-19(24)14-4-3-7-20(13-14)18(23)16-12-15(5-6-17(16)22)29(25,26)21-8-10-27-11-9-21/h5-6,12,14,22H,2-4,7-11,13H2,1H3 |
| InChIKey | ZTDIOFHYYWPZBD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |