C19H26N2O4S — CID 167983174
(3-cyclopropylpiperidin-1-yl)-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)methanone (PubChem CID 167983174) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is (3-cyclopropylpiperidin-1-yl)-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)methanone.
| Compound Name | (3-cyclopropylpiperidin-1-yl)-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 167983174 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (3-cyclopropylpiperidin-1-yl)-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)methanone |
| SMILES | O=C(c1cc(S(=O)(=O)N2CCCC2)ccc1O)N1CCCC(C2CC2)C1 |
| InChI | InChI=1S/C19H26N2O4S/c22-18-8-7-16(26(24,25)21-10-1-2-11-21)12-17(18)19(23)20-9-3-4-15(13-20)14-5-6-14/h7-8,12,14-15,22H,1-6,9-11,13H2 |
| InChIKey | POAIUHSOVDZPFN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |