C17H23ClN2O4S — CID 78802539
(2-chloro-5-piperidin-1-ylsulfonylphenyl)-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 78802539) has the molecular formula C17H23ClN2O4S and a molecular weight of 386.90 g/mol. Its IUPAC name is (2-chloro-5-piperidin-1-ylsulfonylphenyl)-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | (2-chloro-5-piperidin-1-ylsulfonylphenyl)-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 78802539 |
| Molecular Formula | C17H23ClN2O4S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | (2-chloro-5-piperidin-1-ylsulfonylphenyl)-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl)N1CCC(O)CC1 |
| InChI | InChI=1S/C17H23ClN2O4S/c18-16-5-4-14(25(23,24)20-8-2-1-3-9-20)12-15(16)17(22)19-10-6-13(21)7-11-19/h4-5,12-13,21H,1-3,6-11H2 |
| InChIKey | SLJZJPNTSGRBLR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |