C19H23NO6S — CID 7932691
[2-(4-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate (PubChem CID 7932691) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7932691 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [2-(4-morpholin-4-ylsulfonylphenyl)-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(COC(=O)[C@H]1CC=CCC1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H23NO6S/c21-18(14-26-19(22)16-4-2-1-3-5-16)15-6-8-17(9-7-15)27(23,24)20-10-12-25-13-11-20/h1-2,6-9,16H,3-5,10-14H2/t16-/m0/s1 |
| InChIKey | WQHGJFGSFVMTTK-INIZCTEOSA-N |
| XLogP | 1.79 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|