C21H17FO5S — CID 19646566
[2-(4-fluorophenyl)-2-oxoethyl] 3-naphthalen-2-ylsulfonylpropanoate (PubChem CID 19646566) has the molecular formula C21H17FO5S and a molecular weight of 400.43 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 3-naphthalen-2-ylsulfonylpropanoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-naphthalen-2-ylsulfonylpropanoate |
|---|---|
| PubChem CID | 19646566 |
| Molecular Formula | C21H17FO5S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-naphthalen-2-ylsulfonylpropanoate |
| SMILES | O=C(CCS(=O)(=O)c1ccc2ccccc2c1)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FO5S/c22-18-8-5-16(6-9-18)20(23)14-27-21(24)11-12-28(25,26)19-10-7-15-3-1-2-4-17(15)13-19/h1-10,13H,11-12,14H2 |
| InChIKey | CPZRHXCZVTYFKU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |