C24H29NO5 — CID 19939699
6-[4-(4-methoxyphenyl)phenoxy]hexyl N-(2-methylprop-2-enoyl)carbamate (PubChem CID 19939699) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is 6-[4-(4-methoxyphenyl)phenoxy]hexyl N-(2-methylprop-2-enoyl)carbamate.
| Compound Name | 6-[4-(4-methoxyphenyl)phenoxy]hexyl N-(2-methylprop-2-enoyl)carbamate |
|---|---|
| PubChem CID | 19939699 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 6-[4-(4-methoxyphenyl)phenoxy]hexyl N-(2-methylprop-2-enoyl)carbamate |
| SMILES | C=C(C)C(=O)NC(=O)OCCCCCCOc1ccc(-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H29NO5/c1-18(2)23(26)25-24(27)30-17-7-5-4-6-16-29-22-14-10-20(11-15-22)19-8-12-21(28-3)13-9-19/h8-15H,1,4-7,16-17H2,2-3H3,(H,25,26,27) |
| InChIKey | SKJVJCQYIFOLSA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|