C17H18O4S — CID 51414163
(1R,2S,3S,4S)-3-[(4-methylsulfanylphenyl)methoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 51414163) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is (1R,2S,3S,4S)-3-[(4-methylsulfanylphenyl)methoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3S,4S)-3-[(4-methylsulfanylphenyl)methoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 51414163 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (1R,2S,3S,4S)-3-[(4-methylsulfanylphenyl)methoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CSc1ccc(COC(=O)[C@@H]2[C@@H](C(=O)O)[C@H]3C=C[C@@H]2C3)cc1 |
| InChI | InChI=1S/C17H18O4S/c1-22-13-6-2-10(3-7-13)9-21-17(20)15-12-5-4-11(8-12)14(15)16(18)19/h2-7,11-12,14-15H,8-9H2,1H3,(H,18,19)/t11-,12+,14-,15-/m0/s1 |
| InChIKey | UYRUDUWLPYMHLW-NEBZKDRISA-N |
| XLogP | 2.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|