C16H16O2 — CID 54012844
(6-methylnaphthalen-2-yl)methyl cyclopropanecarboxylate (PubChem CID 54012844) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (6-methylnaphthalen-2-yl)methyl cyclopropanecarboxylate.
| Compound Name | (6-methylnaphthalen-2-yl)methyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 54012844 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (6-methylnaphthalen-2-yl)methyl cyclopropanecarboxylate |
| SMILES | Cc1ccc2cc(COC(=O)C3CC3)ccc2c1 |
| InChI | InChI=1S/C16H16O2/c1-11-2-4-15-9-12(3-5-14(15)8-11)10-18-16(17)13-6-7-13/h2-5,8-9,13H,6-7,10H2,1H3 |
| InChIKey | KTOQXWBSNFLFQZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |