About [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate
[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate (PubChem CID 16869408) has the molecular formula C15H15NO3
and a molecular weight of 257.29 g/mol. Its IUPAC name is [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate |
| PubChem CID | 16869408 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate |
| SMILES | Cc1ccc(-c2cc(COC(=O)C3CC3)no2)cc1 |
| InChI | InChI=1S/C15H15NO3/c1-10-2-4-11(5-3-10)14-8-13(16-19-14)9-18-15(17)12-6-7-12/h2-5,8,12H,6-7,9H2,1H3 |
| InChIKey | DRXORQOPOHEEQX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate?
The IUPAC name of [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate (CID 16869408) is [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate.
What is the SMILES notation for [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate?
The canonical SMILES for [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate is Cc1ccc(-c2cc(COC(=O)C3CC3)no2)cc1.
What is the InChIKey of [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate?
The InChIKey is DRXORQOPOHEEQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3/c1-10-2-4-11(5-3-10)14-8-13(16-19-14)9-18-15(17)12-6-7-12/h2-5,8,12H,6-7,9H2,1H3.
What are the key properties of [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate?
[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate has a molecular weight of 257.29 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl cyclopropanecarboxylate is sourced from PubChem (CID 16869408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).