C33H50O5Si — CID 134973540
[(1R,2R,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3-methyl-1-phenyl-1-tri(propan-2-yl)silyloxyhept-6-en-2-yl] acetate (PubChem CID 134973540) has the molecular formula C33H50O5Si and a molecular weight of 554.84 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3-methyl-1-phenyl-1-tri(propan-2-yl)silyloxyhept-6-en-2-yl] acetate.
| Compound Name | [(1R,2R,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3-methyl-1-phenyl-1-tri(propan-2-yl)silyloxyhept-6-en-2-yl] acetate |
|---|---|
| PubChem CID | 134973540 |
| Molecular Formula | C33H50O5Si |
| Molecular Weight | 554.84 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | [(1R,2R,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3-methyl-1-phenyl-1-tri(propan-2-yl)silyloxyhept-6-en-2-yl] acetate |
| SMILES | C=CC[C@H](OCc1ccc(OC)cc1)[C@H](C)[C@@H](OC(C)=O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C33H50O5Si/c1-11-15-31(36-22-28-18-20-30(35-10)21-19-28)26(8)32(37-27(9)34)33(29-16-13-12-14-17-29)38-39(23(2)3,24(4)5)25(6)7/h11-14,16-21,23-26,31-33H,1,15,22H2,2-10H3/t26-,31-,32+,33+/m0/s1 |
| InChIKey | PUVGTEWFAWXUEH-MXXPZBAXSA-N |
| XLogP | 8.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.84 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|