C29H30O4 — CID 52912811
[(1R,2S,3R)-1-methoxy-1-phenyl-2-phenylmethoxyhex-5-en-3-yl] (E)-3-phenylprop-2-enoate (PubChem CID 52912811) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is [(1R,2S,3R)-1-methoxy-1-phenyl-2-phenylmethoxyhex-5-en-3-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1R,2S,3R)-1-methoxy-1-phenyl-2-phenylmethoxyhex-5-en-3-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 52912811 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [(1R,2S,3R)-1-methoxy-1-phenyl-2-phenylmethoxyhex-5-en-3-yl] (E)-3-phenylprop-2-enoate |
| SMILES | C=CC[C@@H](OC(=O)/C=C/c1ccccc1)[C@H](OCc1ccccc1)[C@H](OC)c1ccccc1 |
| InChI | InChI=1S/C29H30O4/c1-3-13-26(33-27(30)21-20-23-14-7-4-8-15-23)29(32-22-24-16-9-5-10-17-24)28(31-2)25-18-11-6-12-19-25/h3-12,14-21,26,28-29H,1,13,22H2,2H3/b21-20+/t26-,28-,29+/m1/s1 |
| InChIKey | YAANAKKOURWYQX-KMSLVHBZSA-N |
| XLogP | 6.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|