C22H32O4 — CID 25058601
[(4S,5S,6R,7S)-6-(methoxymethoxy)-5,7-dimethylnon-1-en-4-yl] (E)-3-phenylprop-2-enoate (PubChem CID 25058601) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(4S,5S,6R,7S)-6-(methoxymethoxy)-5,7-dimethylnon-1-en-4-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(4S,5S,6R,7S)-6-(methoxymethoxy)-5,7-dimethylnon-1-en-4-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 25058601 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(4S,5S,6R,7S)-6-(methoxymethoxy)-5,7-dimethylnon-1-en-4-yl] (E)-3-phenylprop-2-enoate |
| SMILES | C=CC[C@H](OC(=O)/C=C/c1ccccc1)[C@H](C)[C@H](OCOC)[C@@H](C)CC |
| InChI | InChI=1S/C22H32O4/c1-6-11-20(18(4)22(17(3)7-2)25-16-24-5)26-21(23)15-14-19-12-9-8-10-13-19/h6,8-10,12-15,17-18,20,22H,1,7,11,16H2,2-5H3/b15-14+/t17-,18-,20-,22+/m0/s1 |
| InChIKey | LWCRVSQTMGHTME-JURWOIACSA-N |
| XLogP | 4.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|