C14H22N2O3 — CID 174859614
1,1-diethylhydrazine;methyl 3-phenylprop-2-eneperoxoate (PubChem CID 174859614) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1,1-diethylhydrazine;methyl 3-phenylprop-2-eneperoxoate.
| Compound Name | 1,1-diethylhydrazine;methyl 3-phenylprop-2-eneperoxoate |
|---|---|
| PubChem CID | 174859614 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1,1-diethylhydrazine;methyl 3-phenylprop-2-eneperoxoate |
| SMILES | CCN(N)CC.COOC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C10H10O3.C4H12N2/c1-12-13-10(11)8-7-9-5-3-2-4-6-9;1-3-6(5)4-2/h2-8H,1H3;3-5H2,1-2H3 |
| InChIKey | RKSPVCHJJLEQMG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|