C26H46O5Si — CID 10552181
(2R,3S,4S)-3-[(4-methoxyphenyl)methoxymethoxymethyl]-4-tri(propan-2-yl)silyloxyhept-6-en-2-ol (PubChem CID 10552181) has the molecular formula C26H46O5Si and a molecular weight of 466.74 g/mol. Its IUPAC name is (2R,3S,4S)-3-[(4-methoxyphenyl)methoxymethoxymethyl]-4-tri(propan-2-yl)silyloxyhept-6-en-2-ol.
| Compound Name | (2R,3S,4S)-3-[(4-methoxyphenyl)methoxymethoxymethyl]-4-tri(propan-2-yl)silyloxyhept-6-en-2-ol |
|---|---|
| PubChem CID | 10552181 |
| Molecular Formula | C26H46O5Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | (2R,3S,4S)-3-[(4-methoxyphenyl)methoxymethoxymethyl]-4-tri(propan-2-yl)silyloxyhept-6-en-2-ol |
| SMILES | C=CC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](COCOCc1ccc(OC)cc1)[C@@H](C)O |
| InChI | InChI=1S/C26H46O5Si/c1-10-11-26(31-32(19(2)3,20(4)5)21(6)7)25(22(8)27)17-30-18-29-16-23-12-14-24(28-9)15-13-23/h10,12-15,19-22,25-27H,1,11,16-18H2,2-9H3/t22-,25+,26+/m1/s1 |
| InChIKey | HPBRLXYSEMDYRX-RZFJZAQRSA-N |
| XLogP | 6.32 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|