C32H58O4Si2 — CID 177405989
triethyl-[(2R,4Z)-1-[(4-methoxyphenyl)methoxy]-4-[2-tri(propan-2-yl)silyloxyethylidene]hept-6-en-2-yl]oxysilane (PubChem CID 177405989) has the molecular formula C32H58O4Si2 and a molecular weight of 562.98 g/mol. Its IUPAC name is triethyl-[(2R,4Z)-1-[(4-methoxyphenyl)methoxy]-4-[2-tri(propan-2-yl)silyloxyethylidene]hept-6-en-2-yl]oxysilane.
| Compound Name | triethyl-[(2R,4Z)-1-[(4-methoxyphenyl)methoxy]-4-[2-tri(propan-2-yl)silyloxyethylidene]hept-6-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 177405989 |
| Molecular Formula | C32H58O4Si2 |
| Molecular Weight | 562.98 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | triethyl-[(2R,4Z)-1-[(4-methoxyphenyl)methoxy]-4-[2-tri(propan-2-yl)silyloxyethylidene]hept-6-en-2-yl]oxysilane |
| SMILES | C=CC/C(=C/CO[Si](C(C)C)(C(C)C)C(C)C)C[C@H](COCc1ccc(OC)cc1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H58O4Si2/c1-12-16-29(21-22-35-38(26(5)6,27(7)8)28(9)10)23-32(36-37(13-2,14-3)15-4)25-34-24-30-17-19-31(33-11)20-18-30/h12,17-21,26-28,32H,1,13-16,22-25H2,2-11H3/b29-21-/t32-/m1/s1 |
| InChIKey | GUIJRYRDGUBNPD-GRPHBVMCSA-N |
| XLogP | 9.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.98 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|