C33H40O6 — CID 11478142
[(3R,4R)-4-[(4-methoxyphenyl)methoxy]hept-6-en-3-yl] (2S)-2,4-bis(phenylmethoxy)butanoate (PubChem CID 11478142) has the molecular formula C33H40O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is [(3R,4R)-4-[(4-methoxyphenyl)methoxy]hept-6-en-3-yl] (2S)-2,4-bis(phenylmethoxy)butanoate.
| Compound Name | [(3R,4R)-4-[(4-methoxyphenyl)methoxy]hept-6-en-3-yl] (2S)-2,4-bis(phenylmethoxy)butanoate |
|---|---|
| PubChem CID | 11478142 |
| Molecular Formula | C33H40O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | [(3R,4R)-4-[(4-methoxyphenyl)methoxy]hept-6-en-3-yl] (2S)-2,4-bis(phenylmethoxy)butanoate |
| SMILES | C=CC[C@@H](OCc1ccc(OC)cc1)[C@@H](CC)OC(=O)[C@H](CCOCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C33H40O6/c1-4-12-31(37-25-28-17-19-29(35-3)20-18-28)30(5-2)39-33(34)32(38-24-27-15-10-7-11-16-27)21-22-36-23-26-13-8-6-9-14-26/h4,6-11,13-20,30-32H,1,5,12,21-25H2,2-3H3/t30-,31-,32+/m1/s1 |
| InChIKey | PBQUEEMMTWLQPR-IWWXRALLSA-N |
| XLogP | 6.67 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|